C15H24ClNO3 — CID 103970598
2-(2-chloroethoxy)ethyl N-(1-adamantyl)carbamate (PubChem CID 103970598) has the molecular formula C15H24ClNO3 and a molecular weight of 301.81 g/mol. Its IUPAC name is 2-(2-chloroethoxy)ethyl N-(1-adamantyl)carbamate.
| Compound Name | 2-(2-chloroethoxy)ethyl N-(1-adamantyl)carbamate |
|---|---|
| PubChem CID | 103970598 |
| Molecular Formula | C15H24ClNO3 |
| Molecular Weight | 301.81 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 2-(2-chloroethoxy)ethyl N-(1-adamantyl)carbamate |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)OCCOCCCl |
| InChI | InChI=1S/C15H24ClNO3/c16-1-2-19-3-4-20-14(18)17-15-8-11-5-12(9-15)7-13(6-11)10-15/h11-13H,1-10H2,(H,17,18) |
| InChIKey | ASNILVAJKQOJJP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.81 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|