C15H23F2NO5S — CID 59602647
4-(1-adamantylcarbamoyloxy)-1,1-difluorobutane-1-sulfonic acid (PubChem CID 59602647) has the molecular formula C15H23F2NO5S and a molecular weight of 367.41 g/mol. Its IUPAC name is 4-(1-adamantylcarbamoyloxy)-1,1-difluorobutane-1-sulfonic acid.
| Compound Name | 4-(1-adamantylcarbamoyloxy)-1,1-difluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 59602647 |
| Molecular Formula | C15H23F2NO5S |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 4-(1-adamantylcarbamoyloxy)-1,1-difluorobutane-1-sulfonic acid |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)OCCCC(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C15H23F2NO5S/c16-15(17,24(20,21)22)2-1-3-23-13(19)18-14-7-10-4-11(8-14)6-12(5-10)9-14/h10-12H,1-9H2,(H,18,19)(H,20,21,22) |
| InChIKey | QBQXNYIWDFBEKX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|