C12H18F2N2O3S — CID 129295001
N-(1-adamantyl)-2,2-difluoro-2-sulfamoylacetamide (PubChem CID 129295001) has the molecular formula C12H18F2N2O3S and a molecular weight of 308.35 g/mol. Its IUPAC name is N-(1-adamantyl)-2,2-difluoro-2-sulfamoylacetamide.
| Compound Name | N-(1-adamantyl)-2,2-difluoro-2-sulfamoylacetamide |
|---|---|
| PubChem CID | 129295001 |
| Molecular Formula | C12H18F2N2O3S |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | N-(1-adamantyl)-2,2-difluoro-2-sulfamoylacetamide |
| SMILES | NS(=O)(=O)C(F)(F)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C12H18F2N2O3S/c13-12(14,20(15,18)19)10(17)16-11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6H2,(H,16,17)(H2,15,18,19) |
| InChIKey | YOMQPPPMQMIIFC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |