C13H16F5NO — CID 102055809
N-(1-adamantyl)-2,2,3,3,3-pentafluoropropanamide (PubChem CID 102055809) has the molecular formula C13H16F5NO and a molecular weight of 297.27 g/mol. Its IUPAC name is N-(1-adamantyl)-2,2,3,3,3-pentafluoropropanamide.
| Compound Name | N-(1-adamantyl)-2,2,3,3,3-pentafluoropropanamide |
|---|---|
| PubChem CID | 102055809 |
| Molecular Formula | C13H16F5NO |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | N-(1-adamantyl)-2,2,3,3,3-pentafluoropropanamide |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H16F5NO/c14-12(15,13(16,17)18)10(20)19-11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6H2,(H,19,20) |
| InChIKey | PJHATOTUXBRXHU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|