C30H44N2O2 — CID 171722423
1-N,4-N-bis(1-adamantyl)bicyclo[2.2.2]octane-1,4-dicarboxamide (PubChem CID 171722423) has the molecular formula C30H44N2O2 and a molecular weight of 464.69 g/mol. Its IUPAC name is 1-N,4-N-bis(1-adamantyl)bicyclo[2.2.2]octane-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis(1-adamantyl)bicyclo[2.2.2]octane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 171722423 |
| Molecular Formula | C30H44N2O2 |
| Molecular Weight | 464.69 g/mol |
| Exact Mass | 464.34 |
| IUPAC Name | 1-N,4-N-bis(1-adamantyl)bicyclo[2.2.2]octane-1,4-dicarboxamide |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)C12CCC(C(=O)NC34CC5CC(CC(C5)C3)C4)(CC1)CC2 |
| InChI | InChI=1S/C30H44N2O2/c33-25(31-29-13-19-7-20(14-29)9-21(8-19)15-29)27-1-2-28(5-3-27,6-4-27)26(34)32-30-16-22-10-23(17-30)12-24(11-22)18-30/h19-24H,1-18H2,(H,31,33)(H,32,34) |
| InChIKey | FDTOQAZMPIWWQC-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.69 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |