C22H31NOS — CID 101478286
N,2-bis(1-adamantyl)-2-oxoethanethioamide (PubChem CID 101478286) has the molecular formula C22H31NOS and a molecular weight of 357.56 g/mol. Its IUPAC name is N,2-bis(1-adamantyl)-2-oxoethanethioamide.
| Compound Name | N,2-bis(1-adamantyl)-2-oxoethanethioamide |
|---|---|
| PubChem CID | 101478286 |
| Molecular Formula | C22H31NOS |
| Molecular Weight | 357.56 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | N,2-bis(1-adamantyl)-2-oxoethanethioamide |
| SMILES | O=C(C(=S)NC12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H31NOS/c24-19(21-7-13-1-14(8-21)3-15(2-13)9-21)20(25)23-22-10-16-4-17(11-22)6-18(5-16)12-22/h13-18H,1-12H2,(H,23,25) |
| InChIKey | NEFLVYNTNJIRIO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.56 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|