C29H42N2O2 — CID 171722498
1-N,4-N-bis(1-adamantyl)bicyclo[2.2.1]heptane-1,4-dicarboxamide (PubChem CID 171722498) has the molecular formula C29H42N2O2 and a molecular weight of 450.67 g/mol. Its IUPAC name is 1-N,4-N-bis(1-adamantyl)bicyclo[2.2.1]heptane-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis(1-adamantyl)bicyclo[2.2.1]heptane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 171722498 |
| Molecular Formula | C29H42N2O2 |
| Molecular Weight | 450.67 g/mol |
| Exact Mass | 450.32 |
| IUPAC Name | 1-N,4-N-bis(1-adamantyl)bicyclo[2.2.1]heptane-1,4-dicarboxamide |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)C12CCC(C(=O)NC34CC5CC(CC(C5)C3)C4)(CC1)C2 |
| InChI | InChI=1S/C29H42N2O2/c32-24(30-28-11-18-5-19(12-28)7-20(6-18)13-28)26-1-2-27(17-26,4-3-26)25(33)31-29-14-21-8-22(15-29)10-23(9-21)16-29/h18-23H,1-17H2,(H,30,32)(H,31,33) |
| InChIKey | MZUAQEGXACLSIT-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.67 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |