About 1-(1-adamantyl)-3-(dimethyl-λ4-sulfanylidene)urea
1-(1-adamantyl)-3-(dimethyl-λ4-sulfanylidene)urea (PubChem CID 176801954) has the molecular formula C13H22N2OS
and a molecular weight of 254.40 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-(dimethyl-λ4-sulfanylidene)urea.
Molecular Properties
| Compound Name | 1-(1-adamantyl)-3-(dimethyl-λ4-sulfanylidene)urea |
| PubChem CID | 176801954 |
| Molecular Formula | C13H22N2OS |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 1-(1-adamantyl)-3-(dimethyl-λ4-sulfanylidene)urea |
| SMILES | CS(C)=NC(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C13H22N2OS/c1-17(2)15-12(16)14-13-6-9-3-10(7-13)5-11(4-9)8-13/h9-11H,3-8H2,1-2H3,(H,14,16) |
| InChIKey | XSDBGSGIUFWRHR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(1-adamantyl)-3-(dimethyl-λ4-sulfanylidene)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-adamantyl)-3-(dimethyl-λ4-sulfanylidene)urea?
The IUPAC name of 1-(1-adamantyl)-3-(dimethyl-λ4-sulfanylidene)urea (CID 176801954) is 1-(1-adamantyl)-3-(dimethyl-λ4-sulfanylidene)urea.
What is the SMILES notation for 1-(1-adamantyl)-3-(dimethyl-λ4-sulfanylidene)urea?
The canonical SMILES for 1-(1-adamantyl)-3-(dimethyl-λ4-sulfanylidene)urea is CS(C)=NC(=O)NC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-(1-adamantyl)-3-(dimethyl-λ4-sulfanylidene)urea?
The InChIKey is XSDBGSGIUFWRHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2OS/c1-17(2)15-12(16)14-13-6-9-3-10(7-13)5-11(4-9)8-13/h9-11H,3-8H2,1-2H3,(H,14,16).
What are the key properties of 1-(1-adamantyl)-3-(dimethyl-λ4-sulfanylidene)urea?
1-(1-adamantyl)-3-(dimethyl-λ4-sulfanylidene)urea has a molecular weight of 254.40 g/mol, XLogP of 2.73, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-adamantyl)-3-(dimethyl-λ4-sulfanylidene)urea is sourced from PubChem (CID 176801954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).