C21H35F2NO5S — CID 59602623
10-(1-adamantylcarbamoyloxy)-1,1-difluorodecane-1-sulfonic acid (PubChem CID 59602623) has the molecular formula C21H35F2NO5S and a molecular weight of 451.58 g/mol. Its IUPAC name is 10-(1-adamantylcarbamoyloxy)-1,1-difluorodecane-1-sulfonic acid.
| Compound Name | 10-(1-adamantylcarbamoyloxy)-1,1-difluorodecane-1-sulfonic acid |
|---|---|
| PubChem CID | 59602623 |
| Molecular Formula | C21H35F2NO5S |
| Molecular Weight | 451.58 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | 10-(1-adamantylcarbamoyloxy)-1,1-difluorodecane-1-sulfonic acid |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)OCCCCCCCCCC(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C21H35F2NO5S/c22-21(23,30(26,27)28)8-6-4-2-1-3-5-7-9-29-19(25)24-20-13-16-10-17(14-20)12-18(11-16)15-20/h16-18H,1-15H2,(H,24,25)(H,26,27,28) |
| InChIKey | GFVWXQPLHMUKAF-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.58 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|