C13H21F2NO5S — CID 59602619
5-(2-bicyclo[2.2.1]heptanylcarbamoyloxy)-1,1-difluoropentane-1-sulfonic acid (PubChem CID 59602619) has the molecular formula C13H21F2NO5S and a molecular weight of 341.38 g/mol. Its IUPAC name is 5-(2-bicyclo[2.2.1]heptanylcarbamoyloxy)-1,1-difluoropentane-1-sulfonic acid.
| Compound Name | 5-(2-bicyclo[2.2.1]heptanylcarbamoyloxy)-1,1-difluoropentane-1-sulfonic acid |
|---|---|
| PubChem CID | 59602619 |
| Molecular Formula | C13H21F2NO5S |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 5-(2-bicyclo[2.2.1]heptanylcarbamoyloxy)-1,1-difluoropentane-1-sulfonic acid |
| SMILES | O=C(NC1CC2CCC1C2)OCCCCC(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C13H21F2NO5S/c14-13(15,22(18,19)20)5-1-2-6-21-12(17)16-11-8-9-3-4-10(11)7-9/h9-11H,1-8H2,(H,16,17)(H,18,19,20) |
| InChIKey | NVNOTSRKCADQSE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|