C9H14FNO4S — CID 89458060
2-(2-bicyclo[2.2.1]heptanylamino)-1-fluoro-2-oxoethanesulfonic acid (PubChem CID 89458060) has the molecular formula C9H14FNO4S and a molecular weight of 251.28 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanylamino)-1-fluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanylamino)-1-fluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 89458060 |
| Molecular Formula | C9H14FNO4S |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanylamino)-1-fluoro-2-oxoethanesulfonic acid |
| SMILES | O=C(NC1CC2CCC1C2)C(F)S(=O)(=O)O |
| InChI | InChI=1S/C9H14FNO4S/c10-8(16(13,14)15)9(12)11-7-4-5-1-2-6(7)3-5/h5-8H,1-4H2,(H,11,12)(H,13,14,15) |
| InChIKey | ACVMEEDDCVZVOS-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|