C17H23N3O2 — CID 130313063
6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-7-yl N-(1-adamantyl)carbamate (PubChem CID 130313063) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-7-yl N-(1-adamantyl)carbamate.
| Compound Name | 6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-7-yl N-(1-adamantyl)carbamate |
|---|---|
| PubChem CID | 130313063 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-7-yl N-(1-adamantyl)carbamate |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)OC1CCn2ccnc21 |
| InChI | InChI=1S/C17H23N3O2/c21-16(22-14-1-3-20-4-2-18-15(14)20)19-17-8-11-5-12(9-17)7-13(6-11)10-17/h2,4,11-14H,1,3,5-10H2,(H,19,21) |
| InChIKey | VQHMWQGWPAGKBC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |