C26H39NO2 — CID 123615435
[4-(2,2,5-trimethylhexan-3-yl)phenyl] N-(1-adamantyl)carbamate (PubChem CID 123615435) has the molecular formula C26H39NO2 and a molecular weight of 397.60 g/mol. Its IUPAC name is [4-(2,2,5-trimethylhexan-3-yl)phenyl] N-(1-adamantyl)carbamate.
| Compound Name | [4-(2,2,5-trimethylhexan-3-yl)phenyl] N-(1-adamantyl)carbamate |
|---|---|
| PubChem CID | 123615435 |
| Molecular Formula | C26H39NO2 |
| Molecular Weight | 397.60 g/mol |
| Exact Mass | 397.30 |
| IUPAC Name | [4-(2,2,5-trimethylhexan-3-yl)phenyl] N-(1-adamantyl)carbamate |
| SMILES | CC(C)CC(c1ccc(OC(=O)NC23CC4CC(CC(C4)C2)C3)cc1)C(C)(C)C |
| InChI | InChI=1S/C26H39NO2/c1-17(2)10-23(25(3,4)5)21-6-8-22(9-7-21)29-24(28)27-26-14-18-11-19(15-26)13-20(12-18)16-26/h6-9,17-20,23H,10-16H2,1-5H3,(H,27,28) |
| InChIKey | ZLDPDCCCWLAGGF-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.60 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |