C22H32O2 — CID 123471594
[4-(2,2,5-trimethylhexan-3-yl)phenyl] bicyclo[2.2.0]hexane-2-carboxylate (PubChem CID 123471594) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is [4-(2,2,5-trimethylhexan-3-yl)phenyl] bicyclo[2.2.0]hexane-2-carboxylate.
| Compound Name | [4-(2,2,5-trimethylhexan-3-yl)phenyl] bicyclo[2.2.0]hexane-2-carboxylate |
|---|---|
| PubChem CID | 123471594 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | [4-(2,2,5-trimethylhexan-3-yl)phenyl] bicyclo[2.2.0]hexane-2-carboxylate |
| SMILES | CC(C)CC(c1ccc(OC(=O)C2CC3CCC32)cc1)C(C)(C)C |
| InChI | InChI=1S/C22H32O2/c1-14(2)12-20(22(3,4)5)15-6-9-17(10-7-15)24-21(23)19-13-16-8-11-18(16)19/h6-7,9-10,14,16,18-20H,8,11-13H2,1-5H3 |
| InChIKey | AXBPQLCEJUQKGL-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|