C28H38O3 — CID 162122296
4-butan-2-ylphenol;(4-butan-2-ylphenyl) bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 162122296) has the molecular formula C28H38O3 and a molecular weight of 422.61 g/mol. Its IUPAC name is 4-butan-2-ylphenol;(4-butan-2-ylphenyl) bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | 4-butan-2-ylphenol;(4-butan-2-ylphenyl) bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 162122296 |
| Molecular Formula | C28H38O3 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | 4-butan-2-ylphenol;(4-butan-2-ylphenyl) bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CCC(C)c1ccc(O)cc1.CCC(C)c1ccc(OC(=O)C2CC3CCC2C3)cc1 |
| InChI | InChI=1S/C18H24O2.C10H14O/c1-3-12(2)14-6-8-16(9-7-14)20-18(19)17-11-13-4-5-15(17)10-13;1-3-8(2)9-4-6-10(11)7-5-9/h6-9,12-13,15,17H,3-5,10-11H2,1-2H3;4-8,11H,3H2,1-2H3 |
| InChIKey | ZHOPMVUEGUWSSB-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|