C18H24O3 — CID 176725477
[3-(2-hydroxybutan-2-yl)phenyl] bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 176725477) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is [3-(2-hydroxybutan-2-yl)phenyl] bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | [3-(2-hydroxybutan-2-yl)phenyl] bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 176725477 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | [3-(2-hydroxybutan-2-yl)phenyl] bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CCC(C)(O)c1cccc(OC(=O)C2CC3CCC2C3)c1 |
| InChI | InChI=1S/C18H24O3/c1-3-18(2,20)14-5-4-6-15(11-14)21-17(19)16-10-12-7-8-13(16)9-12/h4-6,11-13,16,20H,3,7-10H2,1-2H3 |
| InChIKey | COYWPFFUCDJMBS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|