C21H30O4 — CID 89342299
[2-(2-bicyclo[2.2.1]heptanyloxy)-2-(4-butan-2-ylphenoxy)ethyl] acetate (PubChem CID 89342299) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is [2-(2-bicyclo[2.2.1]heptanyloxy)-2-(4-butan-2-ylphenoxy)ethyl] acetate.
| Compound Name | [2-(2-bicyclo[2.2.1]heptanyloxy)-2-(4-butan-2-ylphenoxy)ethyl] acetate |
|---|---|
| PubChem CID | 89342299 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | [2-(2-bicyclo[2.2.1]heptanyloxy)-2-(4-butan-2-ylphenoxy)ethyl] acetate |
| SMILES | CCC(C)c1ccc(OC(COC(C)=O)OC2CC3CCC2C3)cc1 |
| InChI | InChI=1S/C21H30O4/c1-4-14(2)17-7-9-19(10-8-17)24-21(13-23-15(3)22)25-20-12-16-5-6-18(20)11-16/h7-10,14,16,18,20-21H,4-6,11-13H2,1-3H3 |
| InChIKey | LVWOQTUILMSVKM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|