C28H44O2 — CID 118649878
2-[1-(4-butan-2-ylphenoxy)-2,2-diethylbutoxy]adamantane (PubChem CID 118649878) has the molecular formula C28H44O2 and a molecular weight of 412.66 g/mol. Its IUPAC name is 2-[1-(4-butan-2-ylphenoxy)-2,2-diethylbutoxy]adamantane.
| Compound Name | 2-[1-(4-butan-2-ylphenoxy)-2,2-diethylbutoxy]adamantane |
|---|---|
| PubChem CID | 118649878 |
| Molecular Formula | C28H44O2 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.33 |
| IUPAC Name | 2-[1-(4-butan-2-ylphenoxy)-2,2-diethylbutoxy]adamantane |
| SMILES | CCC(C)c1ccc(OC(OC2C3CC4CC(C3)CC2C4)C(CC)(CC)CC)cc1 |
| InChI | InChI=1S/C28H44O2/c1-6-19(5)22-10-12-25(13-11-22)29-27(28(7-2,8-3)9-4)30-26-23-15-20-14-21(17-23)18-24(26)16-20/h10-13,19-21,23-24,26-27H,6-9,14-18H2,1-5H3 |
| InChIKey | JVMYFEHWTXKNPO-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|