C59H80O4 — CID 160596052
4-butan-2-ylphenol;2-[1-(4-butan-2-ylphenoxy)-2,2-diethylbutoxy]adamantane;1-[(4-butan-2-ylphenoxy)methyl]naphthalene (PubChem CID 160596052) has the molecular formula C59H80O4 and a molecular weight of 853.28 g/mol. Its IUPAC name is 4-butan-2-ylphenol;2-[1-(4-butan-2-ylphenoxy)-2,2-diethylbutoxy]adamantane;1-[(4-butan-2-ylphenoxy)methyl]naphthalene.
| Compound Name | 4-butan-2-ylphenol;2-[1-(4-butan-2-ylphenoxy)-2,2-diethylbutoxy]adamantane;1-[(4-butan-2-ylphenoxy)methyl]naphthalene |
|---|---|
| PubChem CID | 160596052 |
| Molecular Formula | C59H80O4 |
| Molecular Weight | 853.28 g/mol |
| Exact Mass | 852.61 |
| IUPAC Name | 4-butan-2-ylphenol;2-[1-(4-butan-2-ylphenoxy)-2,2-diethylbutoxy]adamantane;1-[(4-butan-2-ylphenoxy)methyl]naphthalene |
| SMILES | CCC(C)c1ccc(O)cc1.CCC(C)c1ccc(OC(OC2C3CC4CC(C3)CC2C4)C(CC)(CC)CC)cc1.CCC(C)c1ccc(OCc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C28H44O2.C21H22O.C10H14O/c1-6-19(5)22-10-12-25(13-11-22)29-27(28(7-2,8-3)9-4)30-26-23-15-20-14-21(17-23)18-24(26)16-20;1-3-16(2)17-11-13-20(14-12-17)22-15-19-9-6-8-18-7-4-5-10-21(18)19;1-3-8(2)9-4-6-10(11)7-5-9/h10-13,19-21,23-24,26-27H,6-9,14-18H2,1-5H3;4-14,16H,3,15H2,1-2H3;4-8,11H,3H2,1-2H3 |
| InChIKey | RDQLSJDTQXSNNL-UHFFFAOYSA-N |
| XLogP | 16.80 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.28 |
| LogP ≤ 5 | 16.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|