C16H20O3 — CID 150736064
2-bicyclo[2.2.1]heptanyl 2-(4-hydroxyphenyl)propanoate (PubChem CID 150736064) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]heptanyl 2-(4-hydroxyphenyl)propanoate.
| Compound Name | 2-bicyclo[2.2.1]heptanyl 2-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 150736064 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 2-bicyclo[2.2.1]heptanyl 2-(4-hydroxyphenyl)propanoate |
| SMILES | CC(C(=O)OC1CC2CCC1C2)c1ccc(O)cc1 |
| InChI | InChI=1S/C16H20O3/c1-10(12-4-6-14(17)7-5-12)16(18)19-15-9-11-2-3-13(15)8-11/h4-7,10-11,13,15,17H,2-3,8-9H2,1H3 |
| InChIKey | JSVVPILLMVKHOJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |