C24H29O4S+ — CID 158304431
[1-(2-bicyclo[2.2.1]heptanyloxy)-1-oxopropan-2-yl]-bis(4-methoxyphenyl)sulfanium (PubChem CID 158304431) has the molecular formula C24H29O4S+ and a molecular weight of 413.56 g/mol. Its IUPAC name is [1-(2-bicyclo[2.2.1]heptanyloxy)-1-oxopropan-2-yl]-bis(4-methoxyphenyl)sulfanium.
| Compound Name | [1-(2-bicyclo[2.2.1]heptanyloxy)-1-oxopropan-2-yl]-bis(4-methoxyphenyl)sulfanium |
|---|---|
| PubChem CID | 158304431 |
| Molecular Formula | C24H29O4S+ |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | [1-(2-bicyclo[2.2.1]heptanyloxy)-1-oxopropan-2-yl]-bis(4-methoxyphenyl)sulfanium |
| SMILES | COc1ccc([S+](c2ccc(OC)cc2)C(C)C(=O)OC2CC3CCC2C3)cc1 |
| InChI | InChI=1S/C24H29O4S/c1-16(24(25)28-23-15-17-4-5-18(23)14-17)29(21-10-6-19(26-2)7-11-21)22-12-8-20(27-3)9-13-22/h6-13,16-18,23H,4-5,14-15H2,1-3H3/q+1 |
| InChIKey | VTDYQQFFSZPFNH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|