C15H18O3 — CID 11817452
[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl] 4-methoxybenzoate (PubChem CID 11817452) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is [(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl] 4-methoxybenzoate.
| Compound Name | [(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 11817452 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | [(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)O[C@@H]2C[C@H]3CC[C@@H]2C3)cc1 |
| InChI | InChI=1S/C15H18O3/c1-17-13-6-4-11(5-7-13)15(16)18-14-9-10-2-3-12(14)8-10/h4-7,10,12,14H,2-3,8-9H2,1H3/t10-,12+,14+/m0/s1 |
| InChIKey | DQQZGJOVNASTOH-ZKYQVNSYSA-N |
| XLogP | 3.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |