C22H26N2O6S2 — CID 122191570
[4-[3-(4-sulfamoyloxyphenyl)-1-adamantyl]phenyl] sulfamate (PubChem CID 122191570) has the molecular formula C22H26N2O6S2 and a molecular weight of 478.59 g/mol. Its IUPAC name is [4-[3-(4-sulfamoyloxyphenyl)-1-adamantyl]phenyl] sulfamate.
| Compound Name | [4-[3-(4-sulfamoyloxyphenyl)-1-adamantyl]phenyl] sulfamate |
|---|---|
| PubChem CID | 122191570 |
| Molecular Formula | C22H26N2O6S2 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | [4-[3-(4-sulfamoyloxyphenyl)-1-adamantyl]phenyl] sulfamate |
| SMILES | NS(=O)(=O)Oc1ccc(C23CC4CC(C2)CC(c2ccc(OS(N)(=O)=O)cc2)(C4)C3)cc1 |
| InChI | InChI=1S/C22H26N2O6S2/c23-31(25,26)29-19-5-1-17(2-6-19)21-10-15-9-16(11-21)13-22(12-15,14-21)18-3-7-20(8-4-18)30-32(24,27)28/h1-8,15-16H,9-14H2,(H2,23,25,26)(H2,24,27,28) |
| InChIKey | JXPZIJXFRRHJHP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 138.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |