C40H52N2+2 — CID 155773628
1-[4-[3-[4-(1-azoniatricyclo[3.3.1.13,7]decan-1-yl)phenyl]-1-adamantyl]phenyl]-1-azoniatricyclo[3.3.1.13,7]decane (PubChem CID 155773628) has the molecular formula C40H52N2+2 and a molecular weight of 560.87 g/mol. Its IUPAC name is 1-[4-[3-[4-(1-azoniatricyclo[3.3.1.13,7]decan-1-yl)phenyl]-1-adamantyl]phenyl]-1-azoniatricyclo[3.3.1.13,7]decane.
| Compound Name | 1-[4-[3-[4-(1-azoniatricyclo[3.3.1.13,7]decan-1-yl)phenyl]-1-adamantyl]phenyl]-1-azoniatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 155773628 |
| Molecular Formula | C40H52N2+2 |
| Molecular Weight | 560.87 g/mol |
| Exact Mass | 560.41 |
| IUPAC Name | 1-[4-[3-[4-(1-azoniatricyclo[3.3.1.13,7]decan-1-yl)phenyl]-1-adamantyl]phenyl]-1-azoniatricyclo[3.3.1.13,7]decane |
| SMILES | c1cc([N+]23CC4CC(CC(C4)C2)C3)ccc1C12CC3CC(C1)CC(c1ccc([N+]45CC6CC(CC(C6)C4)C5)cc1)(C3)C2 |
| InChI | InChI=1S/C40H52N2/c1-5-37(41-20-27-9-28(21-41)11-29(10-27)22-41)6-2-35(1)39-16-33-15-34(17-39)19-40(18-33,26-39)36-3-7-38(8-4-36)42-23-30-12-31(24-42)14-32(13-30)25-42/h1-8,27-34H,9-26H2/q+2 |
| InChIKey | ZWDTULGINVTRFV-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.87 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|