C28H28BrOP — CID 158364084
1-bromo-3-(4-diphenylphosphorylphenyl)adamantane (PubChem CID 158364084) has the molecular formula C28H28BrOP and a molecular weight of 491.41 g/mol. Its IUPAC name is 1-bromo-3-(4-diphenylphosphorylphenyl)adamantane.
| Compound Name | 1-bromo-3-(4-diphenylphosphorylphenyl)adamantane |
|---|---|
| PubChem CID | 158364084 |
| Molecular Formula | C28H28BrOP |
| Molecular Weight | 491.41 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | 1-bromo-3-(4-diphenylphosphorylphenyl)adamantane |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1ccc(C23CC4CC(CC(Br)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C28H28BrOP/c29-28-18-21-15-22(19-28)17-27(16-21,20-28)23-11-13-26(14-12-23)31(30,24-7-3-1-4-8-24)25-9-5-2-6-10-25/h1-14,21-22H,15-20H2 |
| InChIKey | UNYBIHRIRDSWNH-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.41 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|