C17H20BrNO2 — CID 98095527
(5S,7S)-1-bromo-3-(4-methyl-3-nitrophenyl)adamantane (PubChem CID 98095527) has the molecular formula C17H20BrNO2 and a molecular weight of 350.26 g/mol. Its IUPAC name is (5S,7S)-1-bromo-3-(4-methyl-3-nitrophenyl)adamantane.
| Compound Name | (5S,7S)-1-bromo-3-(4-methyl-3-nitrophenyl)adamantane |
|---|---|
| PubChem CID | 98095527 |
| Molecular Formula | C17H20BrNO2 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | (5S,7S)-1-bromo-3-(4-methyl-3-nitrophenyl)adamantane |
| SMILES | Cc1ccc(C23C[C@@H]4C[C@H](CC(Br)(C4)C2)C3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H20BrNO2/c1-11-2-3-14(5-15(11)19(20)21)16-6-12-4-13(7-16)9-17(18,8-12)10-16/h2-3,5,12-13H,4,6-10H2,1H3/t12-,13-,16?,17?/m0/s1 |
| InChIKey | MEJHJEXJWUTGCI-SCQRFTTHSA-N |
| XLogP | 4.89 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|