C19H23N3O5 — CID 98462509
N-[(5S,7S)-3-(4-methyl-3,5-dinitrophenyl)-1-adamantyl]acetamide (PubChem CID 98462509) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is N-[(5S,7S)-3-(4-methyl-3,5-dinitrophenyl)-1-adamantyl]acetamide.
| Compound Name | N-[(5S,7S)-3-(4-methyl-3,5-dinitrophenyl)-1-adamantyl]acetamide |
|---|---|
| PubChem CID | 98462509 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-[(5S,7S)-3-(4-methyl-3,5-dinitrophenyl)-1-adamantyl]acetamide |
| SMILES | CC(=O)NC12C[C@H]3C[C@H](C1)CC(c1cc([N+](=O)[O-])c(C)c([N+](=O)[O-])c1)(C3)C2 |
| InChI | InChI=1S/C19H23N3O5/c1-11-16(21(24)25)4-15(5-17(11)22(26)27)18-6-13-3-14(7-18)9-19(8-13,10-18)20-12(2)23/h4-5,13-14H,3,6-10H2,1-2H3,(H,20,23)/t13-,14-,18?,19?/m0/s1 |
| InChIKey | BMJXYIXTVLPQLQ-IHWOHKJGSA-N |
| XLogP | 3.54 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|