C28H31N5O4 — CID 3451947
1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-[3-(4-nitrophenyl)-1-adamantyl]urea (PubChem CID 3451947) has the molecular formula C28H31N5O4 and a molecular weight of 501.59 g/mol. Its IUPAC name is 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-[3-(4-nitrophenyl)-1-adamantyl]urea.
| Compound Name | 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-[3-(4-nitrophenyl)-1-adamantyl]urea |
|---|---|
| PubChem CID | 3451947 |
| Molecular Formula | C28H31N5O4 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-[3-(4-nitrophenyl)-1-adamantyl]urea |
| SMILES | Cc1c(NC(=O)NC23CC4CC(C2)CC(c2ccc([N+](=O)[O-])cc2)(C4)C3)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C28H31N5O4/c1-18-24(25(34)32(31(18)2)22-6-4-3-5-7-22)29-26(35)30-28-15-19-12-20(16-28)14-27(13-19,17-28)21-8-10-23(11-9-21)33(36)37/h3-11,19-20H,12-17H2,1-2H3,(H2,29,30,35) |
| InChIKey | MWNKPPZZUWVDFM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 111.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|