C20H15ClN4O4S — CID 2971544
3-chloro-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-6-nitro-1-benzothiophene-2-carboxamide (PubChem CID 2971544) has the molecular formula C20H15ClN4O4S and a molecular weight of 442.88 g/mol. Its IUPAC name is 3-chloro-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-6-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-6-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 2971544 |
| Molecular Formula | C20H15ClN4O4S |
| Molecular Weight | 442.88 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | 3-chloro-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-6-nitro-1-benzothiophene-2-carboxamide |
| SMILES | Cc1c(NC(=O)c2sc3cc([N+](=O)[O-])ccc3c2Cl)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C20H15ClN4O4S/c1-11-17(20(27)24(23(11)2)12-6-4-3-5-7-12)22-19(26)18-16(21)14-9-8-13(25(28)29)10-15(14)30-18/h3-10H,1-2H3,(H,22,26) |
| InChIKey | AOSMIMXGFRRKLT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 99.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.88 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|