C15H12ClN5O3S — CID 17217235
3-chloro-N-[(E)-(1,5-dimethylpyrazol-4-yl)methylideneamino]-6-nitro-1-benzothiophene-2-carboxamide (PubChem CID 17217235) has the molecular formula C15H12ClN5O3S and a molecular weight of 377.81 g/mol. Its IUPAC name is 3-chloro-N-[(E)-(1,5-dimethylpyrazol-4-yl)methylideneamino]-6-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[(E)-(1,5-dimethylpyrazol-4-yl)methylideneamino]-6-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17217235 |
| Molecular Formula | C15H12ClN5O3S |
| Molecular Weight | 377.81 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | 3-chloro-N-[(E)-(1,5-dimethylpyrazol-4-yl)methylideneamino]-6-nitro-1-benzothiophene-2-carboxamide |
| SMILES | Cc1c(/C=N/NC(=O)c2sc3cc([N+](=O)[O-])ccc3c2Cl)cnn1C |
| InChI | InChI=1S/C15H12ClN5O3S/c1-8-9(7-18-20(8)2)6-17-19-15(22)14-13(16)11-4-3-10(21(23)24)5-12(11)25-14/h3-7H,1-2H3,(H,19,22)/b17-6+ |
| InChIKey | YFGMUQFVRQMIAQ-UBKPWBPPSA-N |
| XLogP | 3.27 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.81 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|