C24H20ClN3O4S — CID 34315623
6-tert-butyl-3-chloro-N-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-1-benzothiophene-2-carboxamide (PubChem CID 34315623) has the molecular formula C24H20ClN3O4S and a molecular weight of 481.96 g/mol. Its IUPAC name is 6-tert-butyl-3-chloro-N-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-1-benzothiophene-2-carboxamide.
| Compound Name | 6-tert-butyl-3-chloro-N-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 34315623 |
| Molecular Formula | C24H20ClN3O4S |
| Molecular Weight | 481.96 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | 6-tert-butyl-3-chloro-N-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-1-benzothiophene-2-carboxamide |
| SMILES | CC(C)(C)c1ccc2c(Cl)c(C(=O)N/N=C\c3ccc(-c4ccc([N+](=O)[O-])cc4)o3)sc2c1 |
| InChI | InChI=1S/C24H20ClN3O4S/c1-24(2,3)15-6-10-18-20(12-15)33-22(21(18)25)23(29)27-26-13-17-9-11-19(32-17)14-4-7-16(8-5-14)28(30)31/h4-13H,1-3H3,(H,27,29)/b26-13- |
| InChIKey | PSRYFSDAZPJSKH-ZMFRSBBQSA-N |
| XLogP | 6.78 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.96 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|