C16H12ClN3O4S — CID 6874702
3-chloro-6-ethyl-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]-1-benzothiophene-2-carboxamide (PubChem CID 6874702) has the molecular formula C16H12ClN3O4S and a molecular weight of 377.81 g/mol. Its IUPAC name is 3-chloro-6-ethyl-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-6-ethyl-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 6874702 |
| Molecular Formula | C16H12ClN3O4S |
| Molecular Weight | 377.81 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | 3-chloro-6-ethyl-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]-1-benzothiophene-2-carboxamide |
| SMILES | CCc1ccc2c(Cl)c(C(=O)N/N=C/c3ccc([N+](=O)[O-])o3)sc2c1 |
| InChI | InChI=1S/C16H12ClN3O4S/c1-2-9-3-5-11-12(7-9)25-15(14(11)17)16(21)19-18-8-10-4-6-13(24-10)20(22)23/h3-8H,2H2,1H3,(H,19,21)/b18-8+ |
| InChIKey | OPMCNCFXBKFPJS-QGMBQPNBSA-N |
| XLogP | 4.38 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.81 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|