C12H9N5O4S — CID 4115626
5-amino-4-cyano-3-methyl-N-[(5-nitrofuran-2-yl)methylideneamino]thiophene-2-carboxamide (PubChem CID 4115626) has the molecular formula C12H9N5O4S and a molecular weight of 319.30 g/mol. Its IUPAC name is 5-amino-4-cyano-3-methyl-N-[(5-nitrofuran-2-yl)methylideneamino]thiophene-2-carboxamide.
| Compound Name | 5-amino-4-cyano-3-methyl-N-[(5-nitrofuran-2-yl)methylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 4115626 |
| Molecular Formula | C12H9N5O4S |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 5-amino-4-cyano-3-methyl-N-[(5-nitrofuran-2-yl)methylideneamino]thiophene-2-carboxamide |
| SMILES | Cc1c(C(=O)NN=Cc2ccc([N+](=O)[O-])o2)sc(N)c1C#N |
| InChI | InChI=1S/C12H9N5O4S/c1-6-8(4-13)11(14)22-10(6)12(18)16-15-5-7-2-3-9(21-7)17(19)20/h2-3,5H,14H2,1H3,(H,16,18) |
| InChIKey | TYJUPBGDVVTKCJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 147.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|