C17H11Cl2N3O4S — CID 4150525
3-chloro-N-[(2-chloro-5-nitrophenyl)methylideneamino]-6-methoxy-1-benzothiophene-2-carboxamide (PubChem CID 4150525) has the molecular formula C17H11Cl2N3O4S and a molecular weight of 424.27 g/mol. Its IUPAC name is 3-chloro-N-[(2-chloro-5-nitrophenyl)methylideneamino]-6-methoxy-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[(2-chloro-5-nitrophenyl)methylideneamino]-6-methoxy-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4150525 |
| Molecular Formula | C17H11Cl2N3O4S |
| Molecular Weight | 424.27 g/mol |
| Exact Mass | 422.98 |
| IUPAC Name | 3-chloro-N-[(2-chloro-5-nitrophenyl)methylideneamino]-6-methoxy-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc2c(Cl)c(C(=O)NN=Cc3cc([N+](=O)[O-])ccc3Cl)sc2c1 |
| InChI | InChI=1S/C17H11Cl2N3O4S/c1-26-11-3-4-12-14(7-11)27-16(15(12)19)17(23)21-20-8-9-6-10(22(24)25)2-5-13(9)18/h2-8H,1H3,(H,21,23) |
| InChIKey | FXIGPWFLDXRPLK-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.27 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|