C15H10Cl2N6O5 — CID 126842911
1,3-bis[(E)-(2-chloro-5-nitrophenyl)methylideneamino]urea (PubChem CID 126842911) has the molecular formula C15H10Cl2N6O5 and a molecular weight of 425.19 g/mol. Its IUPAC name is 1,3-bis[(E)-(2-chloro-5-nitrophenyl)methylideneamino]urea.
| Compound Name | 1,3-bis[(E)-(2-chloro-5-nitrophenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 126842911 |
| Molecular Formula | C15H10Cl2N6O5 |
| Molecular Weight | 425.19 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | 1,3-bis[(E)-(2-chloro-5-nitrophenyl)methylideneamino]urea |
| SMILES | O=C(N/N=C/c1cc([N+](=O)[O-])ccc1Cl)N/N=C/c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C15H10Cl2N6O5/c16-13-3-1-11(22(25)26)5-9(13)7-18-20-15(24)21-19-8-10-6-12(23(27)28)2-4-14(10)17/h1-8H,(H2,20,21,24)/b18-7+,19-8+ |
| InChIKey | HPJJIIKRDCOPOV-NDILIQOGSA-N |
| XLogP | 3.48 |
| TPSA | 152.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.19 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|