C24H16ClN3O6S — CID 3396585
[4-[[(4-nitrobenzoyl)hydrazinylidene]methyl]phenyl] 3-chloro-6-methoxy-1-benzothiophene-2-carboxylate (PubChem CID 3396585) has the molecular formula C24H16ClN3O6S and a molecular weight of 509.93 g/mol. Its IUPAC name is [4-[[(4-nitrobenzoyl)hydrazinylidene]methyl]phenyl] 3-chloro-6-methoxy-1-benzothiophene-2-carboxylate.
| Compound Name | [4-[[(4-nitrobenzoyl)hydrazinylidene]methyl]phenyl] 3-chloro-6-methoxy-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 3396585 |
| Molecular Formula | C24H16ClN3O6S |
| Molecular Weight | 509.93 g/mol |
| Exact Mass | 509.04 |
| IUPAC Name | [4-[[(4-nitrobenzoyl)hydrazinylidene]methyl]phenyl] 3-chloro-6-methoxy-1-benzothiophene-2-carboxylate |
| SMILES | COc1ccc2c(Cl)c(C(=O)Oc3ccc(C=NNC(=O)c4ccc([N+](=O)[O-])cc4)cc3)sc2c1 |
| InChI | InChI=1S/C24H16ClN3O6S/c1-33-18-10-11-19-20(12-18)35-22(21(19)25)24(30)34-17-8-2-14(3-9-17)13-26-27-23(29)15-4-6-16(7-5-15)28(31)32/h2-13H,1H3,(H,27,29) |
| InChIKey | YRTRYYGNUYPKGV-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.93 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|