C25H18Cl2N2O5S — CID 3616654
[4-[[[2-(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-6-methoxy-1-benzothiophene-2-carboxylate (PubChem CID 3616654) has the molecular formula C25H18Cl2N2O5S and a molecular weight of 529.40 g/mol. Its IUPAC name is [4-[[[2-(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-6-methoxy-1-benzothiophene-2-carboxylate.
| Compound Name | [4-[[[2-(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-6-methoxy-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 3616654 |
| Molecular Formula | C25H18Cl2N2O5S |
| Molecular Weight | 529.40 g/mol |
| Exact Mass | 528.03 |
| IUPAC Name | [4-[[[2-(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-6-methoxy-1-benzothiophene-2-carboxylate |
| SMILES | COc1ccc2c(Cl)c(C(=O)Oc3ccc(C=NNC(=O)COc4ccc(Cl)cc4)cc3)sc2c1 |
| InChI | InChI=1S/C25H18Cl2N2O5S/c1-32-19-10-11-20-21(12-19)35-24(23(20)27)25(31)34-18-6-2-15(3-7-18)13-28-29-22(30)14-33-17-8-4-16(26)5-9-17/h2-13H,14H2,1H3,(H,29,30) |
| InChIKey | WSZBZHJZMUCIHO-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.40 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|