C23H16ClN3O4S — CID 6025019
[4-[(Z)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 3-chloro-6-methoxy-1-benzothiophene-2-carboxylate (PubChem CID 6025019) has the molecular formula C23H16ClN3O4S and a molecular weight of 465.92 g/mol. Its IUPAC name is [4-[(Z)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 3-chloro-6-methoxy-1-benzothiophene-2-carboxylate.
| Compound Name | [4-[(Z)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 3-chloro-6-methoxy-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 6025019 |
| Molecular Formula | C23H16ClN3O4S |
| Molecular Weight | 465.92 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | [4-[(Z)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 3-chloro-6-methoxy-1-benzothiophene-2-carboxylate |
| SMILES | COc1ccc2c(Cl)c(C(=O)Oc3ccc(/C=N\NC(=O)c4ccncc4)cc3)sc2c1 |
| InChI | InChI=1S/C23H16ClN3O4S/c1-30-17-6-7-18-19(12-17)32-21(20(18)24)23(29)31-16-4-2-14(3-5-16)13-26-27-22(28)15-8-10-25-11-9-15/h2-13H,1H3,(H,27,28)/b26-13- |
| InChIKey | WELKBDFCFSJKGF-ZMFRSBBQSA-N |
| XLogP | 4.94 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.92 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|