C23H15ClN2O4S — CID 2247457
[4-[[(4-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 2247457) has the molecular formula C23H15ClN2O4S and a molecular weight of 450.90 g/mol. Its IUPAC name is [4-[[(4-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [4-[[(4-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 2247457 |
| Molecular Formula | C23H15ClN2O4S |
| Molecular Weight | 450.90 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | [4-[[(4-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | O=C(NN=Cc1ccc(OC(=O)c2sc3ccccc3c2Cl)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C23H15ClN2O4S/c24-20-18-3-1-2-4-19(18)31-21(20)23(29)30-17-11-5-14(6-12-17)13-25-26-22(28)15-7-9-16(27)10-8-15/h1-13,27H,(H,26,28) |
| InChIKey | XEYBVFHEFYTUOO-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.90 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|