C29H21Cl3N2O3S2 — CID 45128969
[4-[(E)-[(6-tert-butyl-3-chloro-1-benzothiophene-2-carbonyl)hydrazinylidene]methyl]phenyl] 3,4-dichloro-1-benzothiophene-2-carboxylate (PubChem CID 45128969) has the molecular formula C29H21Cl3N2O3S2 and a molecular weight of 615.99 g/mol. Its IUPAC name is [4-[(E)-[(6-tert-butyl-3-chloro-1-benzothiophene-2-carbonyl)hydrazinylidene]methyl]phenyl] 3,4-dichloro-1-benzothiophene-2-carboxylate.
| Compound Name | [4-[(E)-[(6-tert-butyl-3-chloro-1-benzothiophene-2-carbonyl)hydrazinylidene]methyl]phenyl] 3,4-dichloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 45128969 |
| Molecular Formula | C29H21Cl3N2O3S2 |
| Molecular Weight | 615.99 g/mol |
| Exact Mass | 614.01 |
| IUPAC Name | [4-[(E)-[(6-tert-butyl-3-chloro-1-benzothiophene-2-carbonyl)hydrazinylidene]methyl]phenyl] 3,4-dichloro-1-benzothiophene-2-carboxylate |
| SMILES | CC(C)(C)c1ccc2c(Cl)c(C(=O)N/N=C/c3ccc(OC(=O)c4sc5cccc(Cl)c5c4Cl)cc3)sc2c1 |
| InChI | InChI=1S/C29H21Cl3N2O3S2/c1-29(2,3)16-9-12-18-21(13-16)39-25(23(18)31)27(35)34-33-14-15-7-10-17(11-8-15)37-28(36)26-24(32)22-19(30)5-4-6-20(22)38-26/h4-14H,1-3H3,(H,34,35)/b33-14+ |
| InChIKey | SOUVSEWZVPTAHY-ZHSUKTGHSA-N |
| XLogP | 9.36 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.99 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|