C25H18ClN3O5S — CID 51060643
[4-[(E)-[[2-(4-methoxyanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 51060643) has the molecular formula C25H18ClN3O5S and a molecular weight of 507.96 g/mol. Its IUPAC name is [4-[(E)-[[2-(4-methoxyanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [4-[(E)-[[2-(4-methoxyanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 51060643 |
| Molecular Formula | C25H18ClN3O5S |
| Molecular Weight | 507.96 g/mol |
| Exact Mass | 507.07 |
| IUPAC Name | [4-[(E)-[[2-(4-methoxyanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | COc1ccc(NC(=O)C(=O)N/N=C/c2ccc(OC(=O)c3sc4ccccc4c3Cl)cc2)cc1 |
| InChI | InChI=1S/C25H18ClN3O5S/c1-33-17-12-8-16(9-13-17)28-23(30)24(31)29-27-14-15-6-10-18(11-7-15)34-25(32)22-21(26)19-4-2-3-5-20(19)35-22/h2-14H,1H3,(H,28,30)(H,29,31)/b27-14+ |
| InChIKey | ODEKNITZIHFCHI-MZJWZYIUSA-N |
| XLogP | 4.87 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.96 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|