C25H18ClN3O6S — CID 4116942
[4-[[2-(4-nitrophenoxy)propanoylhydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 4116942) has the molecular formula C25H18ClN3O6S and a molecular weight of 523.95 g/mol. Its IUPAC name is [4-[[2-(4-nitrophenoxy)propanoylhydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [4-[[2-(4-nitrophenoxy)propanoylhydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 4116942 |
| Molecular Formula | C25H18ClN3O6S |
| Molecular Weight | 523.95 g/mol |
| Exact Mass | 523.06 |
| IUPAC Name | [4-[[2-(4-nitrophenoxy)propanoylhydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | CC(Oc1ccc([N+](=O)[O-])cc1)C(=O)NN=Cc1ccc(OC(=O)c2sc3ccccc3c2Cl)cc1 |
| InChI | InChI=1S/C25H18ClN3O6S/c1-15(34-18-12-8-17(9-13-18)29(32)33)24(30)28-27-14-16-6-10-19(11-7-16)35-25(31)23-22(26)20-4-2-3-5-21(20)36-23/h2-15H,1H3,(H,28,30) |
| InChIKey | YGIDAEIZJLKOBK-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.95 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|