C23H18BrN3O6 — CID 4672562
[4-[[2-(4-nitrophenoxy)propanoylhydrazinylidene]methyl]phenyl] 3-bromobenzoate (PubChem CID 4672562) has the molecular formula C23H18BrN3O6 and a molecular weight of 512.32 g/mol. Its IUPAC name is [4-[[2-(4-nitrophenoxy)propanoylhydrazinylidene]methyl]phenyl] 3-bromobenzoate.
| Compound Name | [4-[[2-(4-nitrophenoxy)propanoylhydrazinylidene]methyl]phenyl] 3-bromobenzoate |
|---|---|
| PubChem CID | 4672562 |
| Molecular Formula | C23H18BrN3O6 |
| Molecular Weight | 512.32 g/mol |
| Exact Mass | 511.04 |
| IUPAC Name | [4-[[2-(4-nitrophenoxy)propanoylhydrazinylidene]methyl]phenyl] 3-bromobenzoate |
| SMILES | CC(Oc1ccc([N+](=O)[O-])cc1)C(=O)NN=Cc1ccc(OC(=O)c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C23H18BrN3O6/c1-15(32-20-11-7-19(8-12-20)27(30)31)22(28)26-25-14-16-5-9-21(10-6-16)33-23(29)17-3-2-4-18(24)13-17/h2-15H,1H3,(H,26,28) |
| InChIKey | XJAJFGSISPPMDA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.32 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|