C16H18N2O5 — CID 2834600
4-(1-adamantyl)-2,6-dinitrophenol (PubChem CID 2834600) has the molecular formula C16H18N2O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is 4-(1-adamantyl)-2,6-dinitrophenol.
| Compound Name | 4-(1-adamantyl)-2,6-dinitrophenol |
|---|---|
| PubChem CID | 2834600 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 4-(1-adamantyl)-2,6-dinitrophenol |
| SMILES | O=[N+]([O-])c1cc(C23CC4CC(CC(C4)C2)C3)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C16H18N2O5/c19-15-13(17(20)21)4-12(5-14(15)18(22)23)16-6-9-1-10(7-16)3-11(2-9)8-16/h4-5,9-11,19H,1-3,6-8H2 |
| InChIKey | KDXFWZBDGTUMLL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|