C16H19NO3 — CID 98092473
(5R,7R)-3-(4-nitrophenyl)adamantan-1-ol (PubChem CID 98092473) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is (5R,7R)-3-(4-nitrophenyl)adamantan-1-ol.
| Compound Name | (5R,7R)-3-(4-nitrophenyl)adamantan-1-ol |
|---|---|
| PubChem CID | 98092473 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | (5R,7R)-3-(4-nitrophenyl)adamantan-1-ol |
| SMILES | O=[N+]([O-])c1ccc(C23C[C@H]4C[C@@H](CC(O)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C16H19NO3/c18-16-8-11-5-12(9-16)7-15(6-11,10-16)13-1-3-14(4-2-13)17(19)20/h1-4,11-12,18H,5-10H2/t11-,12-,15?,16?/m1/s1 |
| InChIKey | OLDMLYOVKIBLLL-CPWXYTRJSA-N |
| XLogP | 3.18 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|