C34H36N2O5 — CID 98568729
[(1R)-2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] (5S,7R)-3-(3,4-dimethylphenyl)adamantane-1-carboxylate (PubChem CID 98568729) has the molecular formula C34H36N2O5 and a molecular weight of 552.67 g/mol. Its IUPAC name is [(1R)-2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] (5S,7R)-3-(3,4-dimethylphenyl)adamantane-1-carboxylate.
| Compound Name | [(1R)-2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] (5S,7R)-3-(3,4-dimethylphenyl)adamantane-1-carboxylate |
|---|---|
| PubChem CID | 98568729 |
| Molecular Formula | C34H36N2O5 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | [(1R)-2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] (5S,7R)-3-(3,4-dimethylphenyl)adamantane-1-carboxylate |
| SMILES | Cc1ccc(NC(=O)[C@H](OC(=O)C23C[C@H]4C[C@@H](C2)CC(c2ccc(C)c(C)c2)(C4)C3)c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C34H36N2O5/c1-21-9-12-28(29(13-21)36(39)40)35-31(37)30(26-7-5-4-6-8-26)41-32(38)34-18-24-15-25(19-34)17-33(16-24,20-34)27-11-10-22(2)23(3)14-27/h4-14,24-25,30H,15-20H2,1-3H3,(H,35,37)/t24-,25+,30-,33?,34?/m1/s1 |
| InChIKey | LJZDPRZUOQPXDA-GPWFNSNZSA-N |
| XLogP | 7.28 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|