C70H65BNOP — CID 140705244
[6-[4-[3-(4-diphenylphosphorylphenyl)-1-adamantyl]phenyl]-9-phenylcarbazol-3-yl]-bis(2,4,6-trimethylphenyl)borane (PubChem CID 140705244) has the molecular formula C70H65BNOP and a molecular weight of 978.08 g/mol. Its IUPAC name is [6-[4-[3-(4-diphenylphosphorylphenyl)-1-adamantyl]phenyl]-9-phenylcarbazol-3-yl]-bis(2,4,6-trimethylphenyl)borane.
| Compound Name | [6-[4-[3-(4-diphenylphosphorylphenyl)-1-adamantyl]phenyl]-9-phenylcarbazol-3-yl]-bis(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 140705244 |
| Molecular Formula | C70H65BNOP |
| Molecular Weight | 978.08 g/mol |
| Exact Mass | 977.49 |
| IUPAC Name | [6-[4-[3-(4-diphenylphosphorylphenyl)-1-adamantyl]phenyl]-9-phenylcarbazol-3-yl]-bis(2,4,6-trimethylphenyl)borane |
| SMILES | Cc1cc(C)c(B(c2ccc3c(c2)c2cc(-c4ccc(C56CC7CC(C5)CC(c5ccc(P(=O)(c8ccccc8)c8ccccc8)cc5)(C7)C6)cc4)ccc2n3-c2ccccc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C70H65BNOP/c1-46-34-48(3)67(49(4)35-46)71(68-50(5)36-47(2)37-51(68)6)58-29-33-66-64(40-58)63-39-55(24-32-65(63)72(66)59-16-10-7-11-17-59)54-22-25-56(26-23-54)69-41-52-38-53(42-69)44-70(43-52,45-69)57-27-30-62(31-28-57)74(73,60-18-12-8-13-19-60)61-20-14-9-15-21-61/h7-37,39-40,52-53H,38,41-45H2,1-6H3 |
| InChIKey | GUZUPIOCJWPMSX-UHFFFAOYSA-N |
| XLogP | 14.25 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 978.08 |
| LogP ≤ 5 | 14.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|