C69H73B2N — CID 140705324
[3-[6-[4-[3-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-1-adamantyl]phenyl]-2-pyridinyl]phenyl]-bis(2,4,6-trimethylphenyl)borane (PubChem CID 140705324) has the molecular formula C69H73B2N and a molecular weight of 937.97 g/mol. Its IUPAC name is [3-[6-[4-[3-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-1-adamantyl]phenyl]-2-pyridinyl]phenyl]-bis(2,4,6-trimethylphenyl)borane.
| Compound Name | [3-[6-[4-[3-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-1-adamantyl]phenyl]-2-pyridinyl]phenyl]-bis(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 140705324 |
| Molecular Formula | C69H73B2N |
| Molecular Weight | 937.97 g/mol |
| Exact Mass | 937.59 |
| IUPAC Name | [3-[6-[4-[3-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-1-adamantyl]phenyl]-2-pyridinyl]phenyl]-bis(2,4,6-trimethylphenyl)borane |
| SMILES | Cc1cc(C)c(B(c2ccc(C34CC5CC(C3)CC(c3ccc(-c6cccc(-c7cccc(B(c8c(C)cc(C)cc8C)c8c(C)cc(C)cc8C)c7)n6)cc3)(C5)C4)cc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C69H73B2N/c1-42-27-46(5)64(47(6)28-42)70(65-48(7)29-43(2)30-49(65)8)60-25-23-59(24-26-60)69-39-54-35-55(40-69)38-68(37-54,41-69)58-21-19-56(20-22-58)62-17-14-18-63(72-62)57-15-13-16-61(36-57)71(66-50(9)31-44(3)32-51(66)10)67-52(11)33-45(4)34-53(67)12/h13-34,36,54-55H,35,37-41H2,1-12H3 |
| InChIKey | YENUTODRAFWUJY-UHFFFAOYSA-N |
| XLogP | 12.94 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 937.97 |
| LogP ≤ 5 | 12.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|