C64H58BOPS — CID 140705313
[8-[4-[3-[4-(5-oxobenzo[b]phosphindol-5-yl)phenyl]-1-adamantyl]phenyl]dibenzothiophen-2-yl]-bis(2,4,6-trimethylphenyl)borane (PubChem CID 140705313) has the molecular formula C64H58BOPS and a molecular weight of 917.02 g/mol. Its IUPAC name is [8-[4-[3-[4-(5-oxobenzo[b]phosphindol-5-yl)phenyl]-1-adamantyl]phenyl]dibenzothiophen-2-yl]-bis(2,4,6-trimethylphenyl)borane.
| Compound Name | [8-[4-[3-[4-(5-oxobenzo[b]phosphindol-5-yl)phenyl]-1-adamantyl]phenyl]dibenzothiophen-2-yl]-bis(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 140705313 |
| Molecular Formula | C64H58BOPS |
| Molecular Weight | 917.02 g/mol |
| Exact Mass | 916.40 |
| IUPAC Name | [8-[4-[3-[4-(5-oxobenzo[b]phosphindol-5-yl)phenyl]-1-adamantyl]phenyl]dibenzothiophen-2-yl]-bis(2,4,6-trimethylphenyl)borane |
| SMILES | Cc1cc(C)c(B(c2ccc3sc4ccc(-c5ccc(C67CC8CC(C6)CC(c6ccc(P9(=O)c%10ccccc%10-c%10ccccc%109)cc6)(C8)C7)cc5)cc4c3c2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C64H58BOPS/c1-39-27-41(3)61(42(4)28-39)65(62-43(5)29-40(2)30-44(62)6)51-22-26-60-56(33-51)55-32-48(17-25-59(55)68-60)47-15-18-49(19-16-47)63-34-45-31-46(35-63)37-64(36-45,38-63)50-20-23-52(24-21-50)67(66)57-13-9-7-11-53(57)54-12-8-10-14-58(54)67/h7-30,32-33,45-46H,31,34-38H2,1-6H3 |
| InChIKey | SXSSSIJWRMHJEH-UHFFFAOYSA-N |
| XLogP | 13.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.02 |
| LogP ≤ 5 | 13.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|