C55H57B — CID 140705247
[4-[3-[4-(9,9-dimethylfluoren-2-yl)phenyl]-1-adamantyl]phenyl]-bis(2,4,6-trimethylphenyl)borane (PubChem CID 140705247) has the molecular formula C55H57B and a molecular weight of 728.87 g/mol. Its IUPAC name is [4-[3-[4-(9,9-dimethylfluoren-2-yl)phenyl]-1-adamantyl]phenyl]-bis(2,4,6-trimethylphenyl)borane.
| Compound Name | [4-[3-[4-(9,9-dimethylfluoren-2-yl)phenyl]-1-adamantyl]phenyl]-bis(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 140705247 |
| Molecular Formula | C55H57B |
| Molecular Weight | 728.87 g/mol |
| Exact Mass | 728.46 |
| IUPAC Name | [4-[3-[4-(9,9-dimethylfluoren-2-yl)phenyl]-1-adamantyl]phenyl]-bis(2,4,6-trimethylphenyl)borane |
| SMILES | Cc1cc(C)c(B(c2ccc(C34CC5CC(C3)CC(c3ccc(-c6ccc7c(c6)C(C)(C)c6ccccc6-7)cc3)(C5)C4)cc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C55H57B/c1-34-23-36(3)51(37(4)24-34)56(52-38(5)25-35(2)26-39(52)6)46-20-18-45(19-21-46)55-31-40-27-41(32-55)30-54(29-40,33-55)44-16-13-42(14-17-44)43-15-22-48-47-11-9-10-12-49(47)53(7,8)50(48)28-43/h9-26,28,40-41H,27,29-33H2,1-8H3 |
| InChIKey | MTIGPZALZLZAOR-UHFFFAOYSA-N |
| XLogP | 11.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.87 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|